C12H20N2O3 — CID 174680676
4-(6,6-dimethoxy-1-methyl-2-pyridinyl)morpholine (PubChem CID 174680676) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is 4-(6,6-dimethoxy-1-methyl-2-pyridinyl)morpholine.
| Compound Name | 4-(6,6-dimethoxy-1-methyl-2-pyridinyl)morpholine |
|---|---|
| PubChem CID | 174680676 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 4-(6,6-dimethoxy-1-methyl-2-pyridinyl)morpholine |
| SMILES | COC1(OC)C=CC=C(N2CCOCC2)N1C |
| InChI | InChI=1S/C12H20N2O3/c1-13-11(14-7-9-17-10-8-14)5-4-6-12(13,15-2)16-3/h4-6H,7-10H2,1-3H3 |
| InChIKey | ZDRWYWZGKGDOFY-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|