C13H16F3NO2 — CID 163702109
1-methyl-4-morpholin-4-yl-6-(trifluoromethyl)cyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 163702109) has the molecular formula C13H16F3NO2 and a molecular weight of 275.27 g/mol. Its IUPAC name is 1-methyl-4-morpholin-4-yl-6-(trifluoromethyl)cyclohexa-2,4-diene-1-carbaldehyde.
| Compound Name | 1-methyl-4-morpholin-4-yl-6-(trifluoromethyl)cyclohexa-2,4-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 163702109 |
| Molecular Formula | C13H16F3NO2 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 1-methyl-4-morpholin-4-yl-6-(trifluoromethyl)cyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | CC1(C=O)C=CC(N2CCOCC2)=CC1C(F)(F)F |
| InChI | InChI=1S/C13H16F3NO2/c1-12(9-18)3-2-10(8-11(12)13(14,15)16)17-4-6-19-7-5-17/h2-3,8-9,11H,4-7H2,1H3 |
| InChIKey | KBXMUPQFCAVPDS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|