About 2-phenylprop-1-enyl but-3-enoate
2-phenylprop-1-enyl but-3-enoate (PubChem CID 174681900) has the molecular formula C13H14O2
and a molecular weight of 202.25 g/mol. Its IUPAC name is 2-phenylprop-1-enyl but-3-enoate.
Molecular Properties
| Compound Name | 2-phenylprop-1-enyl but-3-enoate |
| PubChem CID | 174681900 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 2-phenylprop-1-enyl but-3-enoate |
| SMILES | C=CCC(=O)OC=C(C)c1ccccc1 |
| InChI | InChI=1S/C13H14O2/c1-3-7-13(14)15-10-11(2)12-8-5-4-6-9-12/h3-6,8-10H,1,7H2,2H3 |
| InChIKey | IXASNWUTFOEYOY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylprop-1-enyl but-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylprop-1-enyl but-3-enoate?
The IUPAC name of 2-phenylprop-1-enyl but-3-enoate (CID 174681900) is 2-phenylprop-1-enyl but-3-enoate.
What is the SMILES notation for 2-phenylprop-1-enyl but-3-enoate?
The canonical SMILES for 2-phenylprop-1-enyl but-3-enoate is C=CCC(=O)OC=C(C)c1ccccc1.
What is the InChIKey of 2-phenylprop-1-enyl but-3-enoate?
The InChIKey is IXASNWUTFOEYOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O2/c1-3-7-13(14)15-10-11(2)12-8-5-4-6-9-12/h3-6,8-10H,1,7H2,2H3.
What are the key properties of 2-phenylprop-1-enyl but-3-enoate?
2-phenylprop-1-enyl but-3-enoate has a molecular weight of 202.25 g/mol, XLogP of 3.17, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylprop-1-enyl but-3-enoate is sourced from PubChem (CID 174681900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).