C17H17NO6 — CID 174689037
4-(2,4-dihydroxyphenyl)-N,4-dihydroxy-N-methyl-2-oxo-4-phenylbutanamide (PubChem CID 174689037) has the molecular formula C17H17NO6 and a molecular weight of 331.32 g/mol. Its IUPAC name is 4-(2,4-dihydroxyphenyl)-N,4-dihydroxy-N-methyl-2-oxo-4-phenylbutanamide.
| Compound Name | 4-(2,4-dihydroxyphenyl)-N,4-dihydroxy-N-methyl-2-oxo-4-phenylbutanamide |
|---|---|
| PubChem CID | 174689037 |
| Molecular Formula | C17H17NO6 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 4-(2,4-dihydroxyphenyl)-N,4-dihydroxy-N-methyl-2-oxo-4-phenylbutanamide |
| SMILES | CN(O)C(=O)C(=O)CC(O)(c1ccccc1)c1ccc(O)cc1O |
| InChI | InChI=1S/C17H17NO6/c1-18(24)16(22)15(21)10-17(23,11-5-3-2-4-6-11)13-8-7-12(19)9-14(13)20/h2-9,19-20,23-24H,10H2,1H3 |
| InChIKey | CEKQXHCGQUPZDX-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|