C21H16O7 — CID 68559411
1,2-bis(2,4-dihydroxyphenyl)-2-hydroxy-3-phenylpropane-1,3-dione (PubChem CID 68559411) has the molecular formula C21H16O7 and a molecular weight of 380.35 g/mol. Its IUPAC name is 1,2-bis(2,4-dihydroxyphenyl)-2-hydroxy-3-phenylpropane-1,3-dione.
| Compound Name | 1,2-bis(2,4-dihydroxyphenyl)-2-hydroxy-3-phenylpropane-1,3-dione |
|---|---|
| PubChem CID | 68559411 |
| Molecular Formula | C21H16O7 |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 1,2-bis(2,4-dihydroxyphenyl)-2-hydroxy-3-phenylpropane-1,3-dione |
| SMILES | O=C(c1ccccc1)C(O)(C(=O)c1ccc(O)cc1O)c1ccc(O)cc1O |
| InChI | InChI=1S/C21H16O7/c22-13-6-8-15(17(24)10-13)20(27)21(28,16-9-7-14(23)11-18(16)25)19(26)12-4-2-1-3-5-12/h1-11,22-25,28H |
| InChIKey | JNSHAZSSOWDZEW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|