C30H46N2O4 — CID 174689044
1-O-ethyl 2-O-(2-methylpyrazol-3-yl) 3,4-dioctylbenzene-1,2-dicarboxylate (PubChem CID 174689044) has the molecular formula C30H46N2O4 and a molecular weight of 498.71 g/mol. Its IUPAC name is 1-O-ethyl 2-O-(2-methylpyrazol-3-yl) 3,4-dioctylbenzene-1,2-dicarboxylate.
| Compound Name | 1-O-ethyl 2-O-(2-methylpyrazol-3-yl) 3,4-dioctylbenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 174689044 |
| Molecular Formula | C30H46N2O4 |
| Molecular Weight | 498.71 g/mol |
| Exact Mass | 498.35 |
| IUPAC Name | 1-O-ethyl 2-O-(2-methylpyrazol-3-yl) 3,4-dioctylbenzene-1,2-dicarboxylate |
| SMILES | CCCCCCCCc1ccc(C(=O)OCC)c(C(=O)Oc2ccnn2C)c1CCCCCCCC |
| InChI | InChI=1S/C30H46N2O4/c1-5-8-10-12-14-16-18-24-20-21-26(29(33)35-7-3)28(25(24)19-17-15-13-11-9-6-2)30(34)36-27-22-23-31-32(27)4/h20-23H,5-19H2,1-4H3 |
| InChIKey | FZNRJHZKZXSOGI-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.71 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|