C41H55N5O3 — CID 175287786
(2-methylpyrazol-3-yl) 2-[cyclopropylmethyl-(2-phenylimidazol-1-yl)carbamoyl]-3,4-dioctylbenzoate (PubChem CID 175287786) has the molecular formula C41H55N5O3 and a molecular weight of 665.92 g/mol. Its IUPAC name is (2-methylpyrazol-3-yl) 2-[cyclopropylmethyl-(2-phenylimidazol-1-yl)carbamoyl]-3,4-dioctylbenzoate.
| Compound Name | (2-methylpyrazol-3-yl) 2-[cyclopropylmethyl-(2-phenylimidazol-1-yl)carbamoyl]-3,4-dioctylbenzoate |
|---|---|
| PubChem CID | 175287786 |
| Molecular Formula | C41H55N5O3 |
| Molecular Weight | 665.92 g/mol |
| Exact Mass | 665.43 |
| IUPAC Name | (2-methylpyrazol-3-yl) 2-[cyclopropylmethyl-(2-phenylimidazol-1-yl)carbamoyl]-3,4-dioctylbenzoate |
| SMILES | CCCCCCCCc1ccc(C(=O)Oc2ccnn2C)c(C(=O)N(CC2CC2)n2ccnc2-c2ccccc2)c1CCCCCCCC |
| InChI | InChI=1S/C41H55N5O3/c1-4-6-8-10-12-15-19-33-25-26-36(41(48)49-37-27-28-43-44(37)3)38(35(33)22-18-13-11-9-7-5-2)40(47)46(31-32-23-24-32)45-30-29-42-39(45)34-20-16-14-17-21-34/h14,16-17,20-21,25-30,32H,4-13,15,18-19,22-24,31H2,1-3H3 |
| InChIKey | RYMRWUJKTPTMHT-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 82.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.92 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|