About acenaphthylene-5-carboxylic acid;1H-azepine;benzene
acenaphthylene-5-carboxylic acid;1H-azepine;benzene (PubChem CID 174691465) has the molecular formula C25H21NO2
and a molecular weight of 367.45 g/mol. Its IUPAC name is acenaphthylene-5-carboxylic acid;1H-azepine;benzene.
Molecular Properties
| Compound Name | acenaphthylene-5-carboxylic acid;1H-azepine;benzene |
| PubChem CID | 174691465 |
| Molecular Formula | C25H21NO2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | acenaphthylene-5-carboxylic acid;1H-azepine;benzene |
| SMILES | C1=CC=CNC=C1.O=C(O)c1ccc2c3c(cccc13)C=C2.c1ccccc1 |
| InChI | InChI=1S/C13H8O2.C6H7N.C6H6/c14-13(15)11-7-6-9-5-4-8-2-1-3-10(11)12(8)9;1-2-4-6-7-5-3-1;1-2-4-6-5-3-1/h1-7H,(H,14,15);1-7H;1-6H |
| InChIKey | GJMDGTWRNDSPTK-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze acenaphthylene-5-carboxylic acid;1H-azepine;benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acenaphthylene-5-carboxylic acid;1H-azepine;benzene?
The IUPAC name of acenaphthylene-5-carboxylic acid;1H-azepine;benzene (CID 174691465) is acenaphthylene-5-carboxylic acid;1H-azepine;benzene.
What is the SMILES notation for acenaphthylene-5-carboxylic acid;1H-azepine;benzene?
The canonical SMILES for acenaphthylene-5-carboxylic acid;1H-azepine;benzene is C1=CC=CNC=C1.O=C(O)c1ccc2c3c(cccc13)C=C2.c1ccccc1.
What is the InChIKey of acenaphthylene-5-carboxylic acid;1H-azepine;benzene?
The InChIKey is GJMDGTWRNDSPTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8O2.C6H7N.C6H6/c14-13(15)11-7-6-9-5-4-8-2-1-3-10(11)12(8)9;1-2-4-6-7-5-3-1;1-2-4-6-5-3-1/h1-7H,(H,14,15);1-7H;1-6H.
What are the key properties of acenaphthylene-5-carboxylic acid;1H-azepine;benzene?
acenaphthylene-5-carboxylic acid;1H-azepine;benzene has a molecular weight of 367.45 g/mol, XLogP of 5.88, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acenaphthylene-5-carboxylic acid;1H-azepine;benzene is sourced from PubChem (CID 174691465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).