C27H27ClF3N5O3S — CID 174691793
1-[4-[1-[4-[4-chloro-3-(trifluoromethyl)phenyl]piperazin-1-yl]prop-2-enylsulfonyl]phenyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 174691793) has the molecular formula C27H27ClF3N5O3S and a molecular weight of 594.06 g/mol. Its IUPAC name is 1-[4-[1-[4-[4-chloro-3-(trifluoromethyl)phenyl]piperazin-1-yl]prop-2-enylsulfonyl]phenyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[4-[1-[4-[4-chloro-3-(trifluoromethyl)phenyl]piperazin-1-yl]prop-2-enylsulfonyl]phenyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 174691793 |
| Molecular Formula | C27H27ClF3N5O3S |
| Molecular Weight | 594.06 g/mol |
| Exact Mass | 593.15 |
| IUPAC Name | 1-[4-[1-[4-[4-chloro-3-(trifluoromethyl)phenyl]piperazin-1-yl]prop-2-enylsulfonyl]phenyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | C=CC(N1CCN(c2ccc(Cl)c(C(F)(F)F)c2)CC1)S(=O)(=O)c1ccc(NC(=O)NCc2cccnc2)cc1 |
| InChI | InChI=1S/C27H27ClF3N5O3S/c1-2-25(36-14-12-35(13-15-36)21-7-10-24(28)23(16-21)27(29,30)31)40(38,39)22-8-5-20(6-9-22)34-26(37)33-18-19-4-3-11-32-17-19/h2-11,16-17,25H,1,12-15,18H2,(H2,33,34,37) |
| InChIKey | UTTMMVWNJMJJET-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.06 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|