C26H27Cl2N5O3S — CID 174704475
1-[4-[1-[4-(2,3-dichlorophenyl)piperazin-1-yl]prop-2-enylsulfonyl]phenyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 174704475) has the molecular formula C26H27Cl2N5O3S and a molecular weight of 560.51 g/mol. Its IUPAC name is 1-[4-[1-[4-(2,3-dichlorophenyl)piperazin-1-yl]prop-2-enylsulfonyl]phenyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[4-[1-[4-(2,3-dichlorophenyl)piperazin-1-yl]prop-2-enylsulfonyl]phenyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 174704475 |
| Molecular Formula | C26H27Cl2N5O3S |
| Molecular Weight | 560.51 g/mol |
| Exact Mass | 559.12 |
| IUPAC Name | 1-[4-[1-[4-(2,3-dichlorophenyl)piperazin-1-yl]prop-2-enylsulfonyl]phenyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | C=CC(N1CCN(c2cccc(Cl)c2Cl)CC1)S(=O)(=O)c1ccc(NC(=O)NCc2cccnc2)cc1 |
| InChI | InChI=1S/C26H27Cl2N5O3S/c1-2-24(33-15-13-32(14-16-33)23-7-3-6-22(27)25(23)28)37(35,36)21-10-8-20(9-11-21)31-26(34)30-18-19-5-4-12-29-17-19/h2-12,17,24H,1,13-16,18H2,(H2,30,31,34) |
| InChIKey | QBOZJHJNKCSZHV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|