C22H28N4O5S2 — CID 174704435
1-[4-[1-(4-methylsulfonylpiperidin-1-yl)prop-2-enylsulfonyl]phenyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 174704435) has the molecular formula C22H28N4O5S2 and a molecular weight of 492.62 g/mol. Its IUPAC name is 1-[4-[1-(4-methylsulfonylpiperidin-1-yl)prop-2-enylsulfonyl]phenyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[4-[1-(4-methylsulfonylpiperidin-1-yl)prop-2-enylsulfonyl]phenyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 174704435 |
| Molecular Formula | C22H28N4O5S2 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 1-[4-[1-(4-methylsulfonylpiperidin-1-yl)prop-2-enylsulfonyl]phenyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | C=CC(N1CCC(S(C)(=O)=O)CC1)S(=O)(=O)c1ccc(NC(=O)NCc2cccnc2)cc1 |
| InChI | InChI=1S/C22H28N4O5S2/c1-3-21(26-13-10-19(11-14-26)32(2,28)29)33(30,31)20-8-6-18(7-9-20)25-22(27)24-16-17-5-4-12-23-15-17/h3-9,12,15,19,21H,1,10-11,13-14,16H2,2H3,(H2,24,25,27) |
| InChIKey | WJAHGQMDCKZNEZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|