C26H35N5O3S — CID 175280062
1-[4-[1-(4-piperidin-1-ylpiperidin-1-yl)prop-2-enylsulfonyl]phenyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 175280062) has the molecular formula C26H35N5O3S and a molecular weight of 497.67 g/mol. Its IUPAC name is 1-[4-[1-(4-piperidin-1-ylpiperidin-1-yl)prop-2-enylsulfonyl]phenyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[4-[1-(4-piperidin-1-ylpiperidin-1-yl)prop-2-enylsulfonyl]phenyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 175280062 |
| Molecular Formula | C26H35N5O3S |
| Molecular Weight | 497.67 g/mol |
| Exact Mass | 497.25 |
| IUPAC Name | 1-[4-[1-(4-piperidin-1-ylpiperidin-1-yl)prop-2-enylsulfonyl]phenyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | C=CC(N1CCC(N2CCCCC2)CC1)S(=O)(=O)c1ccc(NC(=O)NCc2cccnc2)cc1 |
| InChI | InChI=1S/C26H35N5O3S/c1-2-25(31-17-12-23(13-18-31)30-15-4-3-5-16-30)35(33,34)24-10-8-22(9-11-24)29-26(32)28-20-21-7-6-14-27-19-21/h2,6-11,14,19,23,25H,1,3-5,12-13,15-18,20H2,(H2,28,29,32) |
| InChIKey | ODSOYUXGPUAUEQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.67 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|