C20H25N5O3S — CID 174704660
1-[4-(1-piperidin-1-ylprop-2-enylsulfonyl)phenyl]-3-(pyrimidin-5-ylmethyl)urea (PubChem CID 174704660) has the molecular formula C20H25N5O3S and a molecular weight of 415.52 g/mol. Its IUPAC name is 1-[4-(1-piperidin-1-ylprop-2-enylsulfonyl)phenyl]-3-(pyrimidin-5-ylmethyl)urea.
| Compound Name | 1-[4-(1-piperidin-1-ylprop-2-enylsulfonyl)phenyl]-3-(pyrimidin-5-ylmethyl)urea |
|---|---|
| PubChem CID | 174704660 |
| Molecular Formula | C20H25N5O3S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 1-[4-(1-piperidin-1-ylprop-2-enylsulfonyl)phenyl]-3-(pyrimidin-5-ylmethyl)urea |
| SMILES | C=CC(N1CCCCC1)S(=O)(=O)c1ccc(NC(=O)NCc2cncnc2)cc1 |
| InChI | InChI=1S/C20H25N5O3S/c1-2-19(25-10-4-3-5-11-25)29(27,28)18-8-6-17(7-9-18)24-20(26)23-14-16-12-21-15-22-13-16/h2,6-9,12-13,15,19H,1,3-5,10-11,14H2,(H2,23,24,26) |
| InChIKey | WSLCKBVDPCVEOP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|