C6H12N2O2S3 — CID 174694955
acetic acid;1,3-thiazolidin-2-yl carbamodithioate (PubChem CID 174694955) has the molecular formula C6H12N2O2S3 and a molecular weight of 240.37 g/mol. Its IUPAC name is acetic acid;1,3-thiazolidin-2-yl carbamodithioate.
| Compound Name | acetic acid;1,3-thiazolidin-2-yl carbamodithioate |
|---|---|
| PubChem CID | 174694955 |
| Molecular Formula | C6H12N2O2S3 |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | acetic acid;1,3-thiazolidin-2-yl carbamodithioate |
| SMILES | CC(=O)O.NC(=S)SC1NCCS1 |
| InChI | InChI=1S/C4H8N2S3.C2H4O2/c5-3(7)9-4-6-1-2-8-4;1-2(3)4/h4,6H,1-2H2,(H2,5,7);1H3,(H,3,4) |
| InChIKey | WLJGPIYEDBVRSL-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|