C15H14N2O2 — CID 174698134
4-(1H-1,4-benzodiazepin-2-yl)cyclohexane-1,3-dione (PubChem CID 174698134) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 4-(1H-1,4-benzodiazepin-2-yl)cyclohexane-1,3-dione.
| Compound Name | 4-(1H-1,4-benzodiazepin-2-yl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 174698134 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 4-(1H-1,4-benzodiazepin-2-yl)cyclohexane-1,3-dione |
| SMILES | O=C1CCC(C2=CN=Cc3ccccc3N2)C(=O)C1 |
| InChI | InChI=1S/C15H14N2O2/c18-11-5-6-12(15(19)7-11)14-9-16-8-10-3-1-2-4-13(10)17-14/h1-4,8-9,12,17H,5-7H2 |
| InChIKey | LLSCEHGUZVEDRX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|