C9H17N3O6 — CID 174719874
nitro nitrate;2,2,6,6-tetramethylpiperidin-4-one (PubChem CID 174719874) has the molecular formula C9H17N3O6 and a molecular weight of 263.25 g/mol. Its IUPAC name is nitro nitrate;2,2,6,6-tetramethylpiperidin-4-one.
| Compound Name | nitro nitrate;2,2,6,6-tetramethylpiperidin-4-one |
|---|---|
| PubChem CID | 174719874 |
| Molecular Formula | C9H17N3O6 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | nitro nitrate;2,2,6,6-tetramethylpiperidin-4-one |
| SMILES | CC1(C)CC(=O)CC(C)(C)N1.O=[N+]([O-])O[N+](=O)[O-] |
| InChI | InChI=1S/C9H17NO.N2O5/c1-8(2)5-7(11)6-9(3,4)10-8;3-1(4)7-2(5)6/h10H,5-6H2,1-4H3; |
| InChIKey | XFQDCALUAXPZON-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|