C15H28F2O2S — CID 174721827
2-(7,7-difluoroheptylsulfanyl)-2-methylheptanoic acid (PubChem CID 174721827) has the molecular formula C15H28F2O2S and a molecular weight of 310.45 g/mol. Its IUPAC name is 2-(7,7-difluoroheptylsulfanyl)-2-methylheptanoic acid.
| Compound Name | 2-(7,7-difluoroheptylsulfanyl)-2-methylheptanoic acid |
|---|---|
| PubChem CID | 174721827 |
| Molecular Formula | C15H28F2O2S |
| Molecular Weight | 310.45 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 2-(7,7-difluoroheptylsulfanyl)-2-methylheptanoic acid |
| SMILES | CCCCCC(C)(SCCCCCCC(F)F)C(=O)O |
| InChI | InChI=1S/C15H28F2O2S/c1-3-4-8-11-15(2,14(18)19)20-12-9-6-5-7-10-13(16)17/h13H,3-12H2,1-2H3,(H,18,19) |
| InChIKey | IZLMOSMUKCWPGV-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.45 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|