About 3-cyclohexyl-2-methyl-1,5-dihydropyrazole
3-cyclohexyl-2-methyl-1,5-dihydropyrazole (PubChem CID 174734952) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 3-cyclohexyl-2-methyl-1,5-dihydropyrazole.
Molecular Properties
| Compound Name | 3-cyclohexyl-2-methyl-1,5-dihydropyrazole |
| PubChem CID | 174734952 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 3-cyclohexyl-2-methyl-1,5-dihydropyrazole |
| SMILES | CN1NCC=C1C1CCCCC1 |
| InChI | InChI=1S/C10H18N2/c1-12-10(7-8-11-12)9-5-3-2-4-6-9/h7,9,11H,2-6,8H2,1H3 |
| InChIKey | VSNXDDJMMQBQKR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cyclohexyl-2-methyl-1,5-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-2-methyl-1,5-dihydropyrazole?
The IUPAC name of 3-cyclohexyl-2-methyl-1,5-dihydropyrazole (CID 174734952) is 3-cyclohexyl-2-methyl-1,5-dihydropyrazole.
What is the SMILES notation for 3-cyclohexyl-2-methyl-1,5-dihydropyrazole?
The canonical SMILES for 3-cyclohexyl-2-methyl-1,5-dihydropyrazole is CN1NCC=C1C1CCCCC1.
What is the InChIKey of 3-cyclohexyl-2-methyl-1,5-dihydropyrazole?
The InChIKey is VSNXDDJMMQBQKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2/c1-12-10(7-8-11-12)9-5-3-2-4-6-9/h7,9,11H,2-6,8H2,1H3.
What are the key properties of 3-cyclohexyl-2-methyl-1,5-dihydropyrazole?
3-cyclohexyl-2-methyl-1,5-dihydropyrazole has a molecular weight of 166.27 g/mol, XLogP of 1.90, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-2-methyl-1,5-dihydropyrazole is sourced from PubChem (CID 174734952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).