C24H24Cl2F6N2O2 — CID 174738871
butyl-[[4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]-2-(trifluoromethyl)phenyl]methyl]carbamic acid (PubChem CID 174738871) has the molecular formula C24H24Cl2F6N2O2 and a molecular weight of 557.36 g/mol. Its IUPAC name is butyl-[[4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]-2-(trifluoromethyl)phenyl]methyl]carbamic acid.
| Compound Name | butyl-[[4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]-2-(trifluoromethyl)phenyl]methyl]carbamic acid |
|---|---|
| PubChem CID | 174738871 |
| Molecular Formula | C24H24Cl2F6N2O2 |
| Molecular Weight | 557.36 g/mol |
| Exact Mass | 556.11 |
| IUPAC Name | butyl-[[4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]-2-(trifluoromethyl)phenyl]methyl]carbamic acid |
| SMILES | CCCCN(Cc1ccc(N2CCC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)cc1C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C24H24Cl2F6N2O2/c1-2-3-7-33(21(35)36)13-15-4-5-19(12-20(15)23(27,28)29)34-8-6-22(14-34,24(30,31)32)16-9-17(25)11-18(26)10-16/h4-5,9-12H,2-3,6-8,13-14H2,1H3,(H,35,36) |
| InChIKey | RDIZTRVBBVVPRN-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.36 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|