About 2-[4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]ethanesulfonic acid
2-[4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]ethanesulfonic acid (PubChem CID 87122893) has the molecular formula C19H18Cl2F3NO3S
and a molecular weight of 468.32 g/mol. Its IUPAC name is 2-[4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]ethanesulfonic acid.
Molecular Properties
| Compound Name | 2-[4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]ethanesulfonic acid |
| PubChem CID | 87122893 |
| Molecular Formula | C19H18Cl2F3NO3S |
| Molecular Weight | 468.32 g/mol |
| Exact Mass | 467.03 |
| IUPAC Name | 2-[4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]ethanesulfonic acid |
| SMILES | O=S(=O)(O)CCc1ccc(N2CCC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C19H18Cl2F3NO3S/c20-15-9-14(10-16(21)11-15)18(19(22,23)24)6-7-25(12-18)17-3-1-13(2-4-17)5-8-29(26,27)28/h1-4,9-11H,5-8,12H2,(H,26,27,28) |
| InChIKey | GCJJVHVWHUXXCB-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.32 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]ethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]ethanesulfonic acid?
The IUPAC name of 2-[4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]ethanesulfonic acid (CID 87122893) is 2-[4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]ethanesulfonic acid.
What is the SMILES notation for 2-[4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]ethanesulfonic acid?
The canonical SMILES for 2-[4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]ethanesulfonic acid is O=S(=O)(O)CCc1ccc(N2CCC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)cc1.
What is the InChIKey of 2-[4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]ethanesulfonic acid?
The InChIKey is GCJJVHVWHUXXCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18Cl2F3NO3S/c20-15-9-14(10-16(21)11-15)18(19(22,23)24)6-7-25(12-18)17-3-1-13(2-4-17)5-8-29(26,27)28/h1-4,9-11H,5-8,12H2,(H,26,27,28).
What are the key properties of 2-[4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]ethanesulfonic acid?
2-[4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]ethanesulfonic acid has a molecular weight of 468.32 g/mol, XLogP of 5.13, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]ethanesulfonic acid is sourced from PubChem (CID 87122893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).