C19H18Cl2F3NO3S — CID 87122893
2-[4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]ethanesulfonic acid (PubChem CID 87122893) has the molecular formula C19H18Cl2F3NO3S and a molecular weight of 468.32 g/mol. Its IUPAC name is 2-[4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]ethanesulfonic acid.
| Compound Name | 2-[4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]ethanesulfonic acid |
|---|---|
| PubChem CID | 87122893 |
| Molecular Formula | C19H18Cl2F3NO3S |
| Molecular Weight | 468.32 g/mol |
| Exact Mass | 467.03 |
| IUPAC Name | 2-[4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]ethanesulfonic acid |
| SMILES | O=S(=O)(O)CCc1ccc(N2CCC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C19H18Cl2F3NO3S/c20-15-9-14(10-16(21)11-15)18(19(22,23)24)6-7-25(12-18)17-3-1-13(2-4-17)5-8-29(26,27)28/h1-4,9-11H,5-8,12H2,(H,26,27,28) |
| InChIKey | GCJJVHVWHUXXCB-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.32 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|