C20H18Cl3F3N4O — CID 56952789
1-[(E)-[2-chloro-4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]methylideneamino]-3-methylurea (PubChem CID 56952789) has the molecular formula C20H18Cl3F3N4O and a molecular weight of 493.74 g/mol. Its IUPAC name is 1-[(E)-[2-chloro-4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]methylideneamino]-3-methylurea.
| Compound Name | 1-[(E)-[2-chloro-4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]methylideneamino]-3-methylurea |
|---|---|
| PubChem CID | 56952789 |
| Molecular Formula | C20H18Cl3F3N4O |
| Molecular Weight | 493.74 g/mol |
| Exact Mass | 492.05 |
| IUPAC Name | 1-[(E)-[2-chloro-4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]methylideneamino]-3-methylurea |
| SMILES | CNC(=O)N/N=C/c1ccc(N2CCC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)cc1Cl |
| InChI | InChI=1S/C20H18Cl3F3N4O/c1-27-18(31)29-28-10-12-2-3-16(9-17(12)23)30-5-4-19(11-30,20(24,25)26)13-6-14(21)8-15(22)7-13/h2-3,6-10H,4-5,11H2,1H3,(H2,27,29,31)/b28-10+ |
| InChIKey | TXNHBHMUABJOHD-ORBVJSQLSA-N |
| XLogP | 5.62 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.74 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|