C27H34Cl2Zr — CID 174745088
dichlorozirconium;3,6-dicyclohexyl-2,7-dimethyl-9H-fluorene (PubChem CID 174745088) has the molecular formula C27H34Cl2Zr and a molecular weight of 520.70 g/mol. Its IUPAC name is dichlorozirconium;3,6-dicyclohexyl-2,7-dimethyl-9H-fluorene.
| Compound Name | dichlorozirconium;3,6-dicyclohexyl-2,7-dimethyl-9H-fluorene |
|---|---|
| PubChem CID | 174745088 |
| Molecular Formula | C27H34Cl2Zr |
| Molecular Weight | 520.70 g/mol |
| Exact Mass | 518.11 |
| IUPAC Name | dichlorozirconium;3,6-dicyclohexyl-2,7-dimethyl-9H-fluorene |
| SMILES | Cc1cc2c(cc1C1CCCCC1)-c1cc(C3CCCCC3)c(C)cc1C2.Cl[Zr]Cl |
| InChI | InChI=1S/C27H34.2ClH.Zr/c1-18-13-22-15-23-14-19(2)25(21-11-7-4-8-12-21)17-27(23)26(22)16-24(18)20-9-5-3-6-10-20;;;/h13-14,16-17,20-21H,3-12,15H2,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | XIUVICRXYSNTGR-UHFFFAOYSA-L |
| XLogP | 9.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.70 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |