About 2-(dimethylamino)-6-[(E)-2-phenylethenyl]phenol;methanesulfinate
2-(dimethylamino)-6-[(E)-2-phenylethenyl]phenol;methanesulfinate (PubChem CID 174746340) has the molecular formula C17H20NO3S-
and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-(dimethylamino)-6-[(E)-2-phenylethenyl]phenol;methanesulfinate.
Molecular Properties
| Compound Name | 2-(dimethylamino)-6-[(E)-2-phenylethenyl]phenol;methanesulfinate |
| PubChem CID | 174746340 |
| Molecular Formula | C17H20NO3S- |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 2-(dimethylamino)-6-[(E)-2-phenylethenyl]phenol;methanesulfinate |
| SMILES | CN(C)c1cccc(/C=C/c2ccccc2)c1O.CS(=O)[O-] |
| InChI | InChI=1S/C16H17NO.CH4O2S/c1-17(2)15-10-6-9-14(16(15)18)12-11-13-7-4-3-5-8-13;1-4(2)3/h3-12,18H,1-2H3;1H3,(H,2,3)/p-1/b12-11+; |
| InChIKey | WHOGMYDTUBGANS-CALJPSDSSA-M |
| XLogP | 3.12 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)-6-[(E)-2-phenylethenyl]phenol;methanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)-6-[(E)-2-phenylethenyl]phenol;methanesulfinate?
The IUPAC name of 2-(dimethylamino)-6-[(E)-2-phenylethenyl]phenol;methanesulfinate (CID 174746340) is 2-(dimethylamino)-6-[(E)-2-phenylethenyl]phenol;methanesulfinate.
What is the SMILES notation for 2-(dimethylamino)-6-[(E)-2-phenylethenyl]phenol;methanesulfinate?
The canonical SMILES for 2-(dimethylamino)-6-[(E)-2-phenylethenyl]phenol;methanesulfinate is CN(C)c1cccc(/C=C/c2ccccc2)c1O.CS(=O)[O-].
What is the InChIKey of 2-(dimethylamino)-6-[(E)-2-phenylethenyl]phenol;methanesulfinate?
The InChIKey is WHOGMYDTUBGANS-CALJPSDSSA-M. The full InChI is InChI=1S/C16H17NO.CH4O2S/c1-17(2)15-10-6-9-14(16(15)18)12-11-13-7-4-3-5-8-13;1-4(2)3/h3-12,18H,1-2H3;1H3,(H,2,3)/p-1/b12-11+;.
What are the key properties of 2-(dimethylamino)-6-[(E)-2-phenylethenyl]phenol;methanesulfinate?
2-(dimethylamino)-6-[(E)-2-phenylethenyl]phenol;methanesulfinate has a molecular weight of 318.42 g/mol, XLogP of 3.12, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)-6-[(E)-2-phenylethenyl]phenol;methanesulfinate is sourced from PubChem (CID 174746340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).