C9H8Cl2N2 — CID 174753149
1,3-dichlorobenzene;1H-pyrazole (PubChem CID 174753149) has the molecular formula C9H8Cl2N2 and a molecular weight of 215.08 g/mol. Its IUPAC name is 1,3-dichlorobenzene;1H-pyrazole.
| Compound Name | 1,3-dichlorobenzene;1H-pyrazole |
|---|---|
| PubChem CID | 174753149 |
| Molecular Formula | C9H8Cl2N2 |
| Molecular Weight | 215.08 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | 1,3-dichlorobenzene;1H-pyrazole |
| SMILES | Clc1cccc(Cl)c1.c1cn[nH]c1 |
| InChI | InChI=1S/C6H4Cl2.C3H4N2/c7-5-2-1-3-6(8)4-5;1-2-4-5-3-1/h1-4H;1-3H,(H,4,5) |
| InChIKey | KAKAZVSHCPVWHC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.08 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |