About triazol-1-yl 3-phenylbutanoate
triazol-1-yl 3-phenylbutanoate (PubChem CID 174754212) has the molecular formula C12H13N3O2
and a molecular weight of 231.26 g/mol. Its IUPAC name is triazol-1-yl 3-phenylbutanoate.
Molecular Properties
| Compound Name | triazol-1-yl 3-phenylbutanoate |
| PubChem CID | 174754212 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | triazol-1-yl 3-phenylbutanoate |
| SMILES | CC(CC(=O)On1ccnn1)c1ccccc1 |
| InChI | InChI=1S/C12H13N3O2/c1-10(11-5-3-2-4-6-11)9-12(16)17-15-8-7-13-14-15/h2-8,10H,9H2,1H3 |
| InChIKey | IQIMEKSPTFKZDJ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ester_of_HOBT', 'substructure': 'N/A'} |
|---|
Analyze triazol-1-yl 3-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triazol-1-yl 3-phenylbutanoate?
The IUPAC name of triazol-1-yl 3-phenylbutanoate (CID 174754212) is triazol-1-yl 3-phenylbutanoate.
What is the SMILES notation for triazol-1-yl 3-phenylbutanoate?
The canonical SMILES for triazol-1-yl 3-phenylbutanoate is CC(CC(=O)On1ccnn1)c1ccccc1.
What is the InChIKey of triazol-1-yl 3-phenylbutanoate?
The InChIKey is IQIMEKSPTFKZDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O2/c1-10(11-5-3-2-4-6-11)9-12(16)17-15-8-7-13-14-15/h2-8,10H,9H2,1H3.
What are the key properties of triazol-1-yl 3-phenylbutanoate?
triazol-1-yl 3-phenylbutanoate has a molecular weight of 231.26 g/mol, XLogP of 1.43, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for triazol-1-yl 3-phenylbutanoate is sourced from PubChem (CID 174754212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).