C8H20O4SSi — CID 174760272
1,1,2-trimethoxy-1-silyl-5-sulfanylpentan-2-ol (PubChem CID 174760272) has the molecular formula C8H20O4SSi and a molecular weight of 240.40 g/mol. Its IUPAC name is 1,1,2-trimethoxy-1-silyl-5-sulfanylpentan-2-ol.
| Compound Name | 1,1,2-trimethoxy-1-silyl-5-sulfanylpentan-2-ol |
|---|---|
| PubChem CID | 174760272 |
| Molecular Formula | C8H20O4SSi |
| Molecular Weight | 240.40 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 1,1,2-trimethoxy-1-silyl-5-sulfanylpentan-2-ol |
| SMILES | COC(O)(CCCS)C([SiH3])(OC)OC |
| InChI | InChI=1S/C8H20O4SSi/c1-10-7(9,5-4-6-13)8(14,11-2)12-3/h9,13H,4-6H2,1-3,14H3 |
| InChIKey | NKGQXAPNLXCSSS-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.40 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|