C13H20N2O2 — CID 174764464
[4-(cyanomethylidene)-3-methylpiperidin-1-yl] 2,2-dimethylpropanoate (PubChem CID 174764464) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is [4-(cyanomethylidene)-3-methylpiperidin-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [4-(cyanomethylidene)-3-methylpiperidin-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174764464 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | [4-(cyanomethylidene)-3-methylpiperidin-1-yl] 2,2-dimethylpropanoate |
| SMILES | CC1CN(OC(=O)C(C)(C)C)CCC1=CC#N |
| InChI | InChI=1S/C13H20N2O2/c1-10-9-15(8-6-11(10)5-7-14)17-12(16)13(2,3)4/h5,10H,6,8-9H2,1-4H3 |
| InChIKey | DJHIFGLTFSOEDS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|