About chloromethane;dimethyl-[(prop-2-enoylamino)methyl]-propylazanium
chloromethane;dimethyl-[(prop-2-enoylamino)methyl]-propylazanium (PubChem CID 174765196) has the molecular formula C10H22ClN2O+
and a molecular weight of 221.75 g/mol. Its IUPAC name is chloromethane;dimethyl-[(prop-2-enoylamino)methyl]-propylazanium.
Molecular Properties
| Compound Name | chloromethane;dimethyl-[(prop-2-enoylamino)methyl]-propylazanium |
| PubChem CID | 174765196 |
| Molecular Formula | C10H22ClN2O+ |
| Molecular Weight | 221.75 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | chloromethane;dimethyl-[(prop-2-enoylamino)methyl]-propylazanium |
| SMILES | C=CC(=O)NC[N+](C)(C)CCC.CCl |
| InChI | InChI=1S/C9H18N2O.CH3Cl/c1-5-7-11(3,4)8-10-9(12)6-2;1-2/h6H,2,5,7-8H2,1,3-4H3;1H3/p+1 |
| InChIKey | HJNBHCQYHASARU-UHFFFAOYSA-O |
| XLogP | 1.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.75 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze chloromethane;dimethyl-[(prop-2-enoylamino)methyl]-propylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethane;dimethyl-[(prop-2-enoylamino)methyl]-propylazanium?
The IUPAC name of chloromethane;dimethyl-[(prop-2-enoylamino)methyl]-propylazanium (CID 174765196) is chloromethane;dimethyl-[(prop-2-enoylamino)methyl]-propylazanium.
What is the SMILES notation for chloromethane;dimethyl-[(prop-2-enoylamino)methyl]-propylazanium?
The canonical SMILES for chloromethane;dimethyl-[(prop-2-enoylamino)methyl]-propylazanium is C=CC(=O)NC[N+](C)(C)CCC.CCl.
What is the InChIKey of chloromethane;dimethyl-[(prop-2-enoylamino)methyl]-propylazanium?
The InChIKey is HJNBHCQYHASARU-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H18N2O.CH3Cl/c1-5-7-11(3,4)8-10-9(12)6-2;1-2/h6H,2,5,7-8H2,1,3-4H3;1H3/p+1.
What are the key properties of chloromethane;dimethyl-[(prop-2-enoylamino)methyl]-propylazanium?
chloromethane;dimethyl-[(prop-2-enoylamino)methyl]-propylazanium has a molecular weight of 221.75 g/mol, XLogP of 1.59, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethane;dimethyl-[(prop-2-enoylamino)methyl]-propylazanium is sourced from PubChem (CID 174765196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).