C19H12N6O2 — CID 174765964
N-[2-(3-cyanophenyl)-8-oxo-9-phenyl-7H-purin-6-yl]formamide (PubChem CID 174765964) has the molecular formula C19H12N6O2 and a molecular weight of 356.35 g/mol. Its IUPAC name is N-[2-(3-cyanophenyl)-8-oxo-9-phenyl-7H-purin-6-yl]formamide.
| Compound Name | N-[2-(3-cyanophenyl)-8-oxo-9-phenyl-7H-purin-6-yl]formamide |
|---|---|
| PubChem CID | 174765964 |
| Molecular Formula | C19H12N6O2 |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | N-[2-(3-cyanophenyl)-8-oxo-9-phenyl-7H-purin-6-yl]formamide |
| SMILES | N#Cc1cccc(-c2nc(NC=O)c3[nH]c(=O)n(-c4ccccc4)c3n2)c1 |
| InChI | InChI=1S/C19H12N6O2/c20-10-12-5-4-6-13(9-12)16-23-17(21-11-26)15-18(24-16)25(19(27)22-15)14-7-2-1-3-8-14/h1-9,11H,(H,22,27)(H,21,23,24,26) |
| InChIKey | VKOQNALQYFLVAB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 116.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|