About ethenyl(trimethoxy)silane;2-phenylethenyl dihydrogen phosphate
ethenyl(trimethoxy)silane;2-phenylethenyl dihydrogen phosphate (PubChem CID 174774176) has the molecular formula C13H21O7PSi
and a molecular weight of 348.36 g/mol. Its IUPAC name is ethenyl(trimethoxy)silane;2-phenylethenyl dihydrogen phosphate.
Molecular Properties
| Compound Name | ethenyl(trimethoxy)silane;2-phenylethenyl dihydrogen phosphate |
| PubChem CID | 174774176 |
| Molecular Formula | C13H21O7PSi |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | ethenyl(trimethoxy)silane;2-phenylethenyl dihydrogen phosphate |
| SMILES | C=C[Si](OC)(OC)OC.O=P(O)(O)OC=Cc1ccccc1 |
| InChI | InChI=1S/C8H9O4P.C5H12O3Si/c9-13(10,11)12-7-6-8-4-2-1-3-5-8;1-5-9(6-2,7-3)8-4/h1-7H,(H2,9,10,11);5H,1H2,2-4H3 |
| InChIKey | RTUMLRSSGJKFNU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethenyl(trimethoxy)silane;2-phenylethenyl dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl(trimethoxy)silane;2-phenylethenyl dihydrogen phosphate?
The IUPAC name of ethenyl(trimethoxy)silane;2-phenylethenyl dihydrogen phosphate (CID 174774176) is ethenyl(trimethoxy)silane;2-phenylethenyl dihydrogen phosphate.
What is the SMILES notation for ethenyl(trimethoxy)silane;2-phenylethenyl dihydrogen phosphate?
The canonical SMILES for ethenyl(trimethoxy)silane;2-phenylethenyl dihydrogen phosphate is C=C[Si](OC)(OC)OC.O=P(O)(O)OC=Cc1ccccc1.
What is the InChIKey of ethenyl(trimethoxy)silane;2-phenylethenyl dihydrogen phosphate?
The InChIKey is RTUMLRSSGJKFNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9O4P.C5H12O3Si/c9-13(10,11)12-7-6-8-4-2-1-3-5-8;1-5-9(6-2,7-3)8-4/h1-7H,(H2,9,10,11);5H,1H2,2-4H3.
What are the key properties of ethenyl(trimethoxy)silane;2-phenylethenyl dihydrogen phosphate?
ethenyl(trimethoxy)silane;2-phenylethenyl dihydrogen phosphate has a molecular weight of 348.36 g/mol, XLogP of 2.36, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl(trimethoxy)silane;2-phenylethenyl dihydrogen phosphate is sourced from PubChem (CID 174774176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).