C10H12N2O2 — CID 174778552
N-(1,2,3,4-tetrahydroisoquinolin-1-yloxy)formamide (PubChem CID 174778552) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is N-(1,2,3,4-tetrahydroisoquinolin-1-yloxy)formamide.
| Compound Name | N-(1,2,3,4-tetrahydroisoquinolin-1-yloxy)formamide |
|---|---|
| PubChem CID | 174778552 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | N-(1,2,3,4-tetrahydroisoquinolin-1-yloxy)formamide |
| SMILES | O=CNOC1NCCc2ccccc21 |
| InChI | InChI=1S/C10H12N2O2/c13-7-12-14-10-9-4-2-1-3-8(9)5-6-11-10/h1-4,7,10-11H,5-6H2,(H,12,13) |
| InChIKey | RIQUMZKWOODAKH-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|