C29H39N3O3 — CID 174790165
2-[[(2S)-2-aminopropanoyl]amino]-2-[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]acetic acid (PubChem CID 174790165) has the molecular formula C29H39N3O3 and a molecular weight of 477.65 g/mol. Its IUPAC name is 2-[[(2S)-2-aminopropanoyl]amino]-2-[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]acetic acid.
| Compound Name | 2-[[(2S)-2-aminopropanoyl]amino]-2-[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]acetic acid |
|---|---|
| PubChem CID | 174790165 |
| Molecular Formula | C29H39N3O3 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.30 |
| IUPAC Name | 2-[[(2S)-2-aminopropanoyl]amino]-2-[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]acetic acid |
| SMILES | C[C@H](N)C(=O)NC(C(=O)O)[C@H]1CC[C@@]2(C)C(=CC[C@@H]3[C@@H]2CC[C@]2(C)C(c4cccnc4)=CC[C@@H]32)C1 |
| InChI | InChI=1S/C29H39N3O3/c1-17(30)26(33)32-25(27(34)35)18-10-12-28(2)20(15-18)6-7-21-23-9-8-22(19-5-4-14-31-16-19)29(23,3)13-11-24(21)28/h4-6,8,14,16-18,21,23-25H,7,9-13,15,30H2,1-3H3,(H,32,33)(H,34,35)/t17-,18-,21-,23-,24-,25?,28-,29+/m0/s1 |
| InChIKey | UPVDNKITFNJWFN-ZPMTWXGESA-N |
| XLogP | 4.57 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|