C4H8N2O4 — CID 174793708
3-nitro-1,4-dioxan-2-amine (PubChem CID 174793708) has the molecular formula C4H8N2O4 and a molecular weight of 148.12 g/mol. Its IUPAC name is 3-nitro-1,4-dioxan-2-amine.
| Compound Name | 3-nitro-1,4-dioxan-2-amine |
|---|---|
| PubChem CID | 174793708 |
| Molecular Formula | C4H8N2O4 |
| Molecular Weight | 148.12 g/mol |
| Exact Mass | 148.05 |
| IUPAC Name | 3-nitro-1,4-dioxan-2-amine |
| SMILES | NC1OCCOC1[N+](=O)[O-] |
| InChI | InChI=1S/C4H8N2O4/c5-3-4(6(7)8)10-2-1-9-3/h3-4H,1-2,5H2 |
| InChIKey | WSZBDMMTPJESNJ-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.12 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|