C13H12ClNO2S — CID 174794822
2-(chloromethyl)-6-(2-thiophen-2-ylethyl)pyridine-3-carboxylic acid (PubChem CID 174794822) has the molecular formula C13H12ClNO2S and a molecular weight of 281.76 g/mol. Its IUPAC name is 2-(chloromethyl)-6-(2-thiophen-2-ylethyl)pyridine-3-carboxylic acid.
| Compound Name | 2-(chloromethyl)-6-(2-thiophen-2-ylethyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 174794822 |
| Molecular Formula | C13H12ClNO2S |
| Molecular Weight | 281.76 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | 2-(chloromethyl)-6-(2-thiophen-2-ylethyl)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(CCc2cccs2)nc1CCl |
| InChI | InChI=1S/C13H12ClNO2S/c14-8-12-11(13(16)17)6-4-9(15-12)3-5-10-2-1-7-18-10/h1-2,4,6-7H,3,5,8H2,(H,16,17) |
| InChIKey | OCLXUJPOVGTERQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.76 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|