About 4-ethylphosphanylaniline
4-ethylphosphanylaniline (PubChem CID 174797902) has the molecular formula C8H12NP
and a molecular weight of 153.16 g/mol. Its IUPAC name is 4-ethylphosphanylaniline.
Molecular Properties
| Compound Name | 4-ethylphosphanylaniline |
| PubChem CID | 174797902 |
| Molecular Formula | C8H12NP |
| Molecular Weight | 153.16 g/mol |
| Exact Mass | 153.07 |
| IUPAC Name | 4-ethylphosphanylaniline |
| SMILES | CCPc1ccc(N)cc1 |
| InChI | InChI=1S/C8H12NP/c1-2-10-8-5-3-7(9)4-6-8/h3-6,10H,2,9H2,1H3 |
| InChIKey | NMOHNCFDSFYFHI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.16 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-ethylphosphanylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylphosphanylaniline?
The IUPAC name of 4-ethylphosphanylaniline (CID 174797902) is 4-ethylphosphanylaniline.
What is the SMILES notation for 4-ethylphosphanylaniline?
The canonical SMILES for 4-ethylphosphanylaniline is CCPc1ccc(N)cc1.
What is the InChIKey of 4-ethylphosphanylaniline?
The InChIKey is NMOHNCFDSFYFHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12NP/c1-2-10-8-5-3-7(9)4-6-8/h3-6,10H,2,9H2,1H3.
What are the key properties of 4-ethylphosphanylaniline?
4-ethylphosphanylaniline has a molecular weight of 153.16 g/mol, XLogP of 1.59, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylphosphanylaniline is sourced from PubChem (CID 174797902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).