C24H26N2O6 — CID 17480787
N-ethyl-2-[2-methoxy-4-[(Z)-[5-oxo-2-(4-propan-2-yloxyphenyl)-1,3-oxazol-4-ylidene]methyl]phenoxy]acetamide (PubChem CID 17480787) has the molecular formula C24H26N2O6 and a molecular weight of 438.48 g/mol. Its IUPAC name is N-ethyl-2-[2-methoxy-4-[(Z)-[5-oxo-2-(4-propan-2-yloxyphenyl)-1,3-oxazol-4-ylidene]methyl]phenoxy]acetamide.
| Compound Name | N-ethyl-2-[2-methoxy-4-[(Z)-[5-oxo-2-(4-propan-2-yloxyphenyl)-1,3-oxazol-4-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 17480787 |
| Molecular Formula | C24H26N2O6 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | N-ethyl-2-[2-methoxy-4-[(Z)-[5-oxo-2-(4-propan-2-yloxyphenyl)-1,3-oxazol-4-ylidene]methyl]phenoxy]acetamide |
| SMILES | CCNC(=O)COc1ccc(/C=C2\N=C(c3ccc(OC(C)C)cc3)OC2=O)cc1OC |
| InChI | InChI=1S/C24H26N2O6/c1-5-25-22(27)14-30-20-11-6-16(13-21(20)29-4)12-19-24(28)32-23(26-19)17-7-9-18(10-8-17)31-15(2)3/h6-13,15H,5,14H2,1-4H3,(H,25,27)/b19-12- |
| InChIKey | LPHDGRGLYSXZLZ-UNOMPAQXSA-N |
| XLogP | 3.34 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|