About dichloro(methoxy)silane;dimethoxymethylsilane
dichloro(methoxy)silane;dimethoxymethylsilane (PubChem CID 174818458) has the molecular formula C4H14Cl2O3Si2
and a molecular weight of 237.23 g/mol. Its IUPAC name is dichloro(methoxy)silane;dimethoxymethylsilane.
Molecular Properties
| Compound Name | dichloro(methoxy)silane;dimethoxymethylsilane |
| PubChem CID | 174818458 |
| Molecular Formula | C4H14Cl2O3Si2 |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 235.99 |
| IUPAC Name | dichloro(methoxy)silane;dimethoxymethylsilane |
| SMILES | COC([SiH3])OC.CO[SiH](Cl)Cl |
| InChI | InChI=1S/C3H10O2Si.CH4Cl2OSi/c1-4-3(6)5-2;1-4-5(2)3/h3H,1-2,6H3;5H,1H3 |
| InChIKey | GRFKOUSKJWPOER-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze dichloro(methoxy)silane;dimethoxymethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro(methoxy)silane;dimethoxymethylsilane?
The IUPAC name of dichloro(methoxy)silane;dimethoxymethylsilane (CID 174818458) is dichloro(methoxy)silane;dimethoxymethylsilane.
What is the SMILES notation for dichloro(methoxy)silane;dimethoxymethylsilane?
The canonical SMILES for dichloro(methoxy)silane;dimethoxymethylsilane is COC([SiH3])OC.CO[SiH](Cl)Cl.
What is the InChIKey of dichloro(methoxy)silane;dimethoxymethylsilane?
The InChIKey is GRFKOUSKJWPOER-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10O2Si.CH4Cl2OSi/c1-4-3(6)5-2;1-4-5(2)3/h3H,1-2,6H3;5H,1H3.
What are the key properties of dichloro(methoxy)silane;dimethoxymethylsilane?
dichloro(methoxy)silane;dimethoxymethylsilane has a molecular weight of 237.23 g/mol, XLogP of -0.24, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro(methoxy)silane;dimethoxymethylsilane is sourced from PubChem (CID 174818458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).