C23H28N4O2 — CID 174829731
1,3-dimethyl-5-nitro-1,3,5-triazinane;1,2,3,4-tetrahydrochrysene (PubChem CID 174829731) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 1,3-dimethyl-5-nitro-1,3,5-triazinane;1,2,3,4-tetrahydrochrysene.
| Compound Name | 1,3-dimethyl-5-nitro-1,3,5-triazinane;1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174829731 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 1,3-dimethyl-5-nitro-1,3,5-triazinane;1,2,3,4-tetrahydrochrysene |
| SMILES | CN1CN(C)CN([N+](=O)[O-])C1.c1ccc2c(c1)ccc1c3c(ccc12)CCCC3 |
| InChI | InChI=1S/C18H16.C5H12N4O2/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-6-3-7(2)5-8(4-6)9(10)11/h1,3,5,7,9-12H,2,4,6,8H2;3-5H2,1-2H3 |
| InChIKey | LIZNIOKJBGTIKV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 52.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|