C23H28N2S — CID 174896349
3,5-dimethyl-1,3,5-thiadiazinane;1,2,3,4-tetrahydrochrysene (PubChem CID 174896349) has the molecular formula C23H28N2S and a molecular weight of 364.56 g/mol. Its IUPAC name is 3,5-dimethyl-1,3,5-thiadiazinane;1,2,3,4-tetrahydrochrysene.
| Compound Name | 3,5-dimethyl-1,3,5-thiadiazinane;1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174896349 |
| Molecular Formula | C23H28N2S |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 3,5-dimethyl-1,3,5-thiadiazinane;1,2,3,4-tetrahydrochrysene |
| SMILES | CN1CSCN(C)C1.c1ccc2c(c1)ccc1c3c(ccc12)CCCC3 |
| InChI | InChI=1S/C18H16.C5H12N2S/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-6-3-7(2)5-8-4-6/h1,3,5,7,9-12H,2,4,6,8H2;3-5H2,1-2H3 |
| InChIKey | NCWOXOGJDHWXLY-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|