About dimethoxymethanamine;propylsilane
dimethoxymethanamine;propylsilane (PubChem CID 174848452) has the molecular formula C6H19NO2Si
and a molecular weight of 165.31 g/mol. Its IUPAC name is dimethoxymethanamine;propylsilane.
Molecular Properties
| Compound Name | dimethoxymethanamine;propylsilane |
| PubChem CID | 174848452 |
| Molecular Formula | C6H19NO2Si |
| Molecular Weight | 165.31 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | dimethoxymethanamine;propylsilane |
| SMILES | CCC[SiH3].COC(N)OC |
| InChI | InChI=1S/C3H9NO2.C3H10Si/c1-5-3(4)6-2;1-2-3-4/h3H,4H2,1-2H3;2-3H2,1,4H3 |
| InChIKey | CBMNPKYFPWKDTA-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.31 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze dimethoxymethanamine;propylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxymethanamine;propylsilane?
The IUPAC name of dimethoxymethanamine;propylsilane (CID 174848452) is dimethoxymethanamine;propylsilane.
What is the SMILES notation for dimethoxymethanamine;propylsilane?
The canonical SMILES for dimethoxymethanamine;propylsilane is CCC[SiH3].COC(N)OC.
What is the InChIKey of dimethoxymethanamine;propylsilane?
The InChIKey is CBMNPKYFPWKDTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9NO2.C3H10Si/c1-5-3(4)6-2;1-2-3-4/h3H,4H2,1-2H3;2-3H2,1,4H3.
What are the key properties of dimethoxymethanamine;propylsilane?
dimethoxymethanamine;propylsilane has a molecular weight of 165.31 g/mol, XLogP of -0.30, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxymethanamine;propylsilane is sourced from PubChem (CID 174848452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).