C8H6F4N2O — CID 174850615
1,3,4,5-tetrafluoro-2-benzofuran-1,3-diamine (PubChem CID 174850615) has the molecular formula C8H6F4N2O and a molecular weight of 222.14 g/mol. Its IUPAC name is 1,3,4,5-tetrafluoro-2-benzofuran-1,3-diamine.
| Compound Name | 1,3,4,5-tetrafluoro-2-benzofuran-1,3-diamine |
|---|---|
| PubChem CID | 174850615 |
| Molecular Formula | C8H6F4N2O |
| Molecular Weight | 222.14 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | 1,3,4,5-tetrafluoro-2-benzofuran-1,3-diamine |
| SMILES | NC1(F)OC(N)(F)c2c1ccc(F)c2F |
| InChI | InChI=1S/C8H6F4N2O/c9-4-2-1-3-5(6(4)10)8(12,14)15-7(3,11)13/h1-2H,13-14H2 |
| InChIKey | GNEUGKQCUQHFKE-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.14 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|