C25H32O2 — CID 174854345
1-(9-ethoxy-1-methyl-9H-fluoren-2-yl)-3-ethylheptan-1-one (PubChem CID 174854345) has the molecular formula C25H32O2 and a molecular weight of 364.53 g/mol. Its IUPAC name is 1-(9-ethoxy-1-methyl-9H-fluoren-2-yl)-3-ethylheptan-1-one.
| Compound Name | 1-(9-ethoxy-1-methyl-9H-fluoren-2-yl)-3-ethylheptan-1-one |
|---|---|
| PubChem CID | 174854345 |
| Molecular Formula | C25H32O2 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 1-(9-ethoxy-1-methyl-9H-fluoren-2-yl)-3-ethylheptan-1-one |
| SMILES | CCCCC(CC)CC(=O)c1ccc2c(c1C)C(OCC)c1ccccc1-2 |
| InChI | InChI=1S/C25H32O2/c1-5-8-11-18(6-2)16-23(26)19-14-15-21-20-12-9-10-13-22(20)25(27-7-3)24(21)17(19)4/h9-10,12-15,18,25H,5-8,11,16H2,1-4H3 |
| InChIKey | BXTDMWANEVWCFE-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |