C6H6FeN4 — CID 174858020
5-cyclopenta-2,4-dien-1-yl-2H-tetrazole;iron (PubChem CID 174858020) has the molecular formula C6H6FeN4 and a molecular weight of 189.99 g/mol. Its IUPAC name is 5-cyclopenta-2,4-dien-1-yl-2H-tetrazole;iron.
| Compound Name | 5-cyclopenta-2,4-dien-1-yl-2H-tetrazole;iron |
|---|---|
| PubChem CID | 174858020 |
| Molecular Formula | C6H6FeN4 |
| Molecular Weight | 189.99 g/mol |
| Exact Mass | 189.99 |
| IUPAC Name | 5-cyclopenta-2,4-dien-1-yl-2H-tetrazole;iron |
| SMILES | C1=CC(c2nn[nH]n2)C=C1.[Fe] |
| InChI | InChI=1S/C6H6N4.Fe/c1-2-4-5(3-1)6-7-9-10-8-6;/h1-5H,(H,7,8,9,10); |
| InChIKey | CFPFZNSPNUJLPA-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.99 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|