About 5-cyclopenta-2,4-dien-1-yl-2H-tetrazole;iron
5-cyclopenta-2,4-dien-1-yl-2H-tetrazole;iron (PubChem CID 174858020) has the molecular formula C6H6FeN4
and a molecular weight of 189.99 g/mol. Its IUPAC name is 5-cyclopenta-2,4-dien-1-yl-2H-tetrazole;iron.
Molecular Properties
| Compound Name | 5-cyclopenta-2,4-dien-1-yl-2H-tetrazole;iron |
| PubChem CID | 174858020 |
| Molecular Formula | C6H6FeN4 |
| Molecular Weight | 189.99 g/mol |
| Exact Mass | 189.99 |
| IUPAC Name | 5-cyclopenta-2,4-dien-1-yl-2H-tetrazole;iron |
| SMILES | C1=CC(c2nn[nH]n2)C=C1.[Fe] |
| InChI | InChI=1S/C6H6N4.Fe/c1-2-4-5(3-1)6-7-9-10-8-6;/h1-5H,(H,7,8,9,10); |
| InChIKey | CFPFZNSPNUJLPA-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.99 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclopenta-2,4-dien-1-yl-2H-tetrazole;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopenta-2,4-dien-1-yl-2H-tetrazole;iron?
The IUPAC name of 5-cyclopenta-2,4-dien-1-yl-2H-tetrazole;iron (CID 174858020) is 5-cyclopenta-2,4-dien-1-yl-2H-tetrazole;iron.
What is the SMILES notation for 5-cyclopenta-2,4-dien-1-yl-2H-tetrazole;iron?
The canonical SMILES for 5-cyclopenta-2,4-dien-1-yl-2H-tetrazole;iron is C1=CC(c2nn[nH]n2)C=C1.[Fe].
What is the InChIKey of 5-cyclopenta-2,4-dien-1-yl-2H-tetrazole;iron?
The InChIKey is CFPFZNSPNUJLPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4.Fe/c1-2-4-5(3-1)6-7-9-10-8-6;/h1-5H,(H,7,8,9,10);.
What are the key properties of 5-cyclopenta-2,4-dien-1-yl-2H-tetrazole;iron?
5-cyclopenta-2,4-dien-1-yl-2H-tetrazole;iron has a molecular weight of 189.99 g/mol, XLogP of 0.41, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopenta-2,4-dien-1-yl-2H-tetrazole;iron is sourced from PubChem (CID 174858020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).