C7H7ClN4 — CID 175705459
5-(6-chlorocyclohexa-2,4-dien-1-yl)-2H-tetrazole (PubChem CID 175705459) has the molecular formula C7H7ClN4 and a molecular weight of 182.61 g/mol. Its IUPAC name is 5-(6-chlorocyclohexa-2,4-dien-1-yl)-2H-tetrazole.
| Compound Name | 5-(6-chlorocyclohexa-2,4-dien-1-yl)-2H-tetrazole |
|---|---|
| PubChem CID | 175705459 |
| Molecular Formula | C7H7ClN4 |
| Molecular Weight | 182.61 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | 5-(6-chlorocyclohexa-2,4-dien-1-yl)-2H-tetrazole |
| SMILES | ClC1C=CC=CC1c1nn[nH]n1 |
| InChI | InChI=1S/C7H7ClN4/c8-6-4-2-1-3-5(6)7-9-11-12-10-7/h1-6H,(H,9,10,11,12) |
| InChIKey | ZFDRCOFOCPUZEY-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.61 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|