About dichloro-tris(2-methylphenyl)-λ5-phosphane;palladium
dichloro-tris(2-methylphenyl)-λ5-phosphane;palladium (PubChem CID 174858130) has the molecular formula C21H21Cl2PPd
and a molecular weight of 481.70 g/mol. Its IUPAC name is dichloro-tris(2-methylphenyl)-λ5-phosphane;palladium.
Molecular Properties
| Compound Name | dichloro-tris(2-methylphenyl)-λ5-phosphane;palladium |
| PubChem CID | 174858130 |
| Molecular Formula | C21H21Cl2PPd |
| Molecular Weight | 481.70 g/mol |
| Exact Mass | 479.98 |
| IUPAC Name | dichloro-tris(2-methylphenyl)-λ5-phosphane;palladium |
| SMILES | Cc1ccccc1P(Cl)(Cl)(c1ccccc1C)c1ccccc1C.[Pd] |
| InChI | InChI=1S/C21H21Cl2P.Pd/c1-16-10-4-7-13-19(16)24(22,23,20-14-8-5-11-17(20)2)21-15-9-6-12-18(21)3;/h4-15H,1-3H3; |
| InChIKey | MSADFUBCQUJWBU-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 481.70 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dichloro-tris(2-methylphenyl)-λ5-phosphane;palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro-tris(2-methylphenyl)-λ5-phosphane;palladium?
The IUPAC name of dichloro-tris(2-methylphenyl)-λ5-phosphane;palladium (CID 174858130) is dichloro-tris(2-methylphenyl)-λ5-phosphane;palladium.
What is the SMILES notation for dichloro-tris(2-methylphenyl)-λ5-phosphane;palladium?
The canonical SMILES for dichloro-tris(2-methylphenyl)-λ5-phosphane;palladium is Cc1ccccc1P(Cl)(Cl)(c1ccccc1C)c1ccccc1C.[Pd].
What is the InChIKey of dichloro-tris(2-methylphenyl)-λ5-phosphane;palladium?
The InChIKey is MSADFUBCQUJWBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21Cl2P.Pd/c1-16-10-4-7-13-19(16)24(22,23,20-14-8-5-11-17(20)2)21-15-9-6-12-18(21)3;/h4-15H,1-3H3;.
What are the key properties of dichloro-tris(2-methylphenyl)-λ5-phosphane;palladium?
dichloro-tris(2-methylphenyl)-λ5-phosphane;palladium has a molecular weight of 481.70 g/mol, XLogP of 5.75, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro-tris(2-methylphenyl)-λ5-phosphane;palladium is sourced from PubChem (CID 174858130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).