C11H30N2O5Si2 — CID 174862202
oxiran-2-ylmethoxysilane;1-trimethoxysilylpentane-1,5-diamine (PubChem CID 174862202) has the molecular formula C11H30N2O5Si2 and a molecular weight of 326.54 g/mol. Its IUPAC name is oxiran-2-ylmethoxysilane;1-trimethoxysilylpentane-1,5-diamine.
| Compound Name | oxiran-2-ylmethoxysilane;1-trimethoxysilylpentane-1,5-diamine |
|---|---|
| PubChem CID | 174862202 |
| Molecular Formula | C11H30N2O5Si2 |
| Molecular Weight | 326.54 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | oxiran-2-ylmethoxysilane;1-trimethoxysilylpentane-1,5-diamine |
| SMILES | CO[Si](OC)(OC)C(N)CCCCN.[SiH3]OCC1CO1 |
| InChI | InChI=1S/C8H22N2O3Si.C3H8O2Si/c1-11-14(12-2,13-3)8(10)6-4-5-7-9;6-5-2-3-1-4-3/h8H,4-7,9-10H2,1-3H3;3H,1-2H2,6H3 |
| InChIKey | CXHXWGUTXZFLGQ-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.54 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|