C10H26N2O3Si — CID 88766718
N',N'-dimethyl-1-trimethoxysilylpentane-1,5-diamine (PubChem CID 88766718) has the molecular formula C10H26N2O3Si and a molecular weight of 250.41 g/mol. Its IUPAC name is N',N'-dimethyl-1-trimethoxysilylpentane-1,5-diamine.
| Compound Name | N',N'-dimethyl-1-trimethoxysilylpentane-1,5-diamine |
|---|---|
| PubChem CID | 88766718 |
| Molecular Formula | C10H26N2O3Si |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | N',N'-dimethyl-1-trimethoxysilylpentane-1,5-diamine |
| SMILES | CO[Si](OC)(OC)C(N)CCCCN(C)C |
| InChI | InChI=1S/C10H26N2O3Si/c1-12(2)9-7-6-8-10(11)16(13-3,14-4)15-5/h10H,6-9,11H2,1-5H3 |
| InChIKey | LXJURNQVONYFQK-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|