C22H50N4O — CID 88657090
3-[1-amino-9-(dimethylamino)nonan-3-yl]oxy-N',N'-dimethylnonane-1,9-diamine (PubChem CID 88657090) has the molecular formula C22H50N4O and a molecular weight of 386.67 g/mol. Its IUPAC name is 3-[1-amino-9-(dimethylamino)nonan-3-yl]oxy-N',N'-dimethylnonane-1,9-diamine.
| Compound Name | 3-[1-amino-9-(dimethylamino)nonan-3-yl]oxy-N',N'-dimethylnonane-1,9-diamine |
|---|---|
| PubChem CID | 88657090 |
| Molecular Formula | C22H50N4O |
| Molecular Weight | 386.67 g/mol |
| Exact Mass | 386.40 |
| IUPAC Name | 3-[1-amino-9-(dimethylamino)nonan-3-yl]oxy-N',N'-dimethylnonane-1,9-diamine |
| SMILES | CN(C)CCCCCCC(CCN)OC(CCN)CCCCCCN(C)C |
| InChI | InChI=1S/C22H50N4O/c1-25(2)19-11-7-5-9-13-21(15-17-23)27-22(16-18-24)14-10-6-8-12-20-26(3)4/h21-22H,5-20,23-24H2,1-4H3 |
| InChIKey | PJGIGTHGHXTYSP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.67 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|