C24H54N4O — CID 88670688
3-[1-amino-9-(dimethylamino)-2-methylnonan-3-yl]oxy-N',N',2-trimethylnonane-1,9-diamine (PubChem CID 88670688) has the molecular formula C24H54N4O and a molecular weight of 414.72 g/mol. Its IUPAC name is 3-[1-amino-9-(dimethylamino)-2-methylnonan-3-yl]oxy-N',N',2-trimethylnonane-1,9-diamine.
| Compound Name | 3-[1-amino-9-(dimethylamino)-2-methylnonan-3-yl]oxy-N',N',2-trimethylnonane-1,9-diamine |
|---|---|
| PubChem CID | 88670688 |
| Molecular Formula | C24H54N4O |
| Molecular Weight | 414.72 g/mol |
| Exact Mass | 414.43 |
| IUPAC Name | 3-[1-amino-9-(dimethylamino)-2-methylnonan-3-yl]oxy-N',N',2-trimethylnonane-1,9-diamine |
| SMILES | CC(CN)C(CCCCCCN(C)C)OC(CCCCCCN(C)C)C(C)CN |
| InChI | InChI=1S/C24H54N4O/c1-21(19-25)23(15-11-7-9-13-17-27(3)4)29-24(22(2)20-26)16-12-8-10-14-18-28(5)6/h21-24H,7-20,25-26H2,1-6H3 |
| InChIKey | OGPPJWQRSRPBEB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.72 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|