About ethyl(heptan-3-yl)azanide;tantalum
ethyl(heptan-3-yl)azanide;tantalum (PubChem CID 174866359) has the molecular formula C9H20NTa-
and a molecular weight of 323.21 g/mol. Its IUPAC name is ethyl(heptan-3-yl)azanide;tantalum.
Molecular Properties
| Compound Name | ethyl(heptan-3-yl)azanide;tantalum |
| PubChem CID | 174866359 |
| Molecular Formula | C9H20NTa- |
| Molecular Weight | 323.21 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | ethyl(heptan-3-yl)azanide;tantalum |
| SMILES | CCCCC(CC)[N-]CC.[Ta] |
| InChI | InChI=1S/C9H20N.Ta/c1-4-7-8-9(5-2)10-6-3;/h9H,4-8H2,1-3H3;/q-1; |
| InChIKey | BOWACWWTDFRUKA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.21 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethyl(heptan-3-yl)azanide;tantalum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl(heptan-3-yl)azanide;tantalum?
The IUPAC name of ethyl(heptan-3-yl)azanide;tantalum (CID 174866359) is ethyl(heptan-3-yl)azanide;tantalum.
What is the SMILES notation for ethyl(heptan-3-yl)azanide;tantalum?
The canonical SMILES for ethyl(heptan-3-yl)azanide;tantalum is CCCCC(CC)[N-]CC.[Ta].
What is the InChIKey of ethyl(heptan-3-yl)azanide;tantalum?
The InChIKey is BOWACWWTDFRUKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N.Ta/c1-4-7-8-9(5-2)10-6-3;/h9H,4-8H2,1-3H3;/q-1;.
What are the key properties of ethyl(heptan-3-yl)azanide;tantalum?
ethyl(heptan-3-yl)azanide;tantalum has a molecular weight of 323.21 g/mol, XLogP of 3.35, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl(heptan-3-yl)azanide;tantalum is sourced from PubChem (CID 174866359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).